C43H28N2 — CID 169071852
2-[4-(1,2,3,4,5,6,7,8-octadeuterio-10-naphthalen-1-ylanthracen-9-yl)phenyl]-1-phenylbenzimidazole (PubChem CID 169071852) has the molecular formula C43H28N2 and a molecular weight of 580.76 g/mol. Its IUPAC name is 2-[4-(1,2,3,4,5,6,7,8-octadeuterio-10-naphthalen-1-ylanthracen-9-yl)phenyl]-1-phenylbenzimidazole.
| Compound Name | 2-[4-(1,2,3,4,5,6,7,8-octadeuterio-10-naphthalen-1-ylanthracen-9-yl)phenyl]-1-phenylbenzimidazole |
|---|---|
| PubChem CID | 169071852 |
| Molecular Formula | C43H28N2 |
| Molecular Weight | 580.76 g/mol |
| Exact Mass | 580.28 |
| IUPAC Name | 2-[4-(1,2,3,4,5,6,7,8-octadeuterio-10-naphthalen-1-ylanthracen-9-yl)phenyl]-1-phenylbenzimidazole |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3cccc4ccccc34)c3c([2H])c([2H])c([2H])c([2H])c3c(-c3ccc(-c4nc5ccccc5n4-c4ccccc4)cc3)c2c1[2H] |
| InChI | InChI=1S/C43H28N2/c1-2-15-32(16-3-1)45-40-24-11-10-23-39(40)44-43(45)31-27-25-30(26-28-31)41-35-18-6-8-20-37(35)42(38-21-9-7-19-36(38)41)34-22-12-14-29-13-4-5-17-33(29)34/h1-28H/i6D,7D,8D,9D,18D,19D,20D,21D |
| InChIKey | KHAUOKHTBREYRG-SQZIYIKASA-N |
| XLogP | 11.49 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.76 |
| LogP ≤ 5 | 11.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|