C37H24N2 — CID 169071034
2-(10-naphthalen-1-ylanthracen-9-yl)-1-(2,3,4,5,6-pentadeuteriophenyl)benzimidazole (PubChem CID 169071034) has the molecular formula C37H24N2 and a molecular weight of 501.64 g/mol. Its IUPAC name is 2-(10-naphthalen-1-ylanthracen-9-yl)-1-(2,3,4,5,6-pentadeuteriophenyl)benzimidazole.
| Compound Name | 2-(10-naphthalen-1-ylanthracen-9-yl)-1-(2,3,4,5,6-pentadeuteriophenyl)benzimidazole |
|---|---|
| PubChem CID | 169071034 |
| Molecular Formula | C37H24N2 |
| Molecular Weight | 501.64 g/mol |
| Exact Mass | 501.23 |
| IUPAC Name | 2-(10-naphthalen-1-ylanthracen-9-yl)-1-(2,3,4,5,6-pentadeuteriophenyl)benzimidazole |
| SMILES | [2H]c1c([2H])c([2H])c(-n2c(-c3c4ccccc4c(-c4cccc5ccccc45)c4ccccc34)nc3ccccc32)c([2H])c1[2H] |
| InChI | InChI=1S/C37H24N2/c1-2-15-26(16-3-1)39-34-24-11-10-23-33(34)38-37(39)36-31-20-8-6-18-29(31)35(30-19-7-9-21-32(30)36)28-22-12-14-25-13-4-5-17-27(25)28/h1-24H/i1D,2D,3D,15D,16D |
| InChIKey | BTJWHSAKTYOUAP-NVQYRDKCSA-N |
| XLogP | 9.82 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.64 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|