C38H25N3 — CID 169070499
1-(2,3,4,5,6-pentadeuteriophenyl)-2-[10-(3-pyridin-3-ylphenyl)anthracen-9-yl]benzimidazole (PubChem CID 169070499) has the molecular formula C38H25N3 and a molecular weight of 528.67 g/mol. Its IUPAC name is 1-(2,3,4,5,6-pentadeuteriophenyl)-2-[10-(3-pyridin-3-ylphenyl)anthracen-9-yl]benzimidazole.
| Compound Name | 1-(2,3,4,5,6-pentadeuteriophenyl)-2-[10-(3-pyridin-3-ylphenyl)anthracen-9-yl]benzimidazole |
|---|---|
| PubChem CID | 169070499 |
| Molecular Formula | C38H25N3 |
| Molecular Weight | 528.67 g/mol |
| Exact Mass | 528.24 |
| IUPAC Name | 1-(2,3,4,5,6-pentadeuteriophenyl)-2-[10-(3-pyridin-3-ylphenyl)anthracen-9-yl]benzimidazole |
| SMILES | [2H]c1c([2H])c([2H])c(-n2c(-c3c4ccccc4c(-c4cccc(-c5cccnc5)c4)c4ccccc34)nc3ccccc32)c([2H])c1[2H] |
| InChI | InChI=1S/C38H25N3/c1-2-15-29(16-3-1)41-35-22-9-8-21-34(35)40-38(41)37-32-19-6-4-17-30(32)36(31-18-5-7-20-33(31)37)27-13-10-12-26(24-27)28-14-11-23-39-25-28/h1-25H/i1D,2D,3D,15D,16D |
| InChIKey | KQHOMPAZTKKXHY-NVQYRDKCSA-N |
| XLogP | 9.73 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.67 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|