C45H30N2 — CID 169071978
2-[2-[1,2,3,4,5,6,7,8-octadeuterio-10-[3-(2,3,4,5,6-pentadeuteriophenyl)phenyl]anthracen-9-yl]phenyl]-1-(2,3,4,5,6-pentadeuteriophenyl)benzimidazole (PubChem CID 169071978) has the molecular formula C45H30N2 and a molecular weight of 616.86 g/mol. Its IUPAC name is 2-[2-[1,2,3,4,5,6,7,8-octadeuterio-10-[3-(2,3,4,5,6-pentadeuteriophenyl)phenyl]anthracen-9-yl]phenyl]-1-(2,3,4,5,6-pentadeuteriophenyl)benzimidazole.
| Compound Name | 2-[2-[1,2,3,4,5,6,7,8-octadeuterio-10-[3-(2,3,4,5,6-pentadeuteriophenyl)phenyl]anthracen-9-yl]phenyl]-1-(2,3,4,5,6-pentadeuteriophenyl)benzimidazole |
|---|---|
| PubChem CID | 169071978 |
| Molecular Formula | C45H30N2 |
| Molecular Weight | 616.86 g/mol |
| Exact Mass | 616.35 |
| IUPAC Name | 2-[2-[1,2,3,4,5,6,7,8-octadeuterio-10-[3-(2,3,4,5,6-pentadeuteriophenyl)phenyl]anthracen-9-yl]phenyl]-1-(2,3,4,5,6-pentadeuteriophenyl)benzimidazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cccc(-c3c4c([2H])c([2H])c([2H])c([2H])c4c(-c4ccccc4-c4nc5ccccc5n4-c4c([2H])c([2H])c([2H])c([2H])c4[2H])c4c([2H])c([2H])c([2H])c([2H])c34)c2)c([2H])c1[2H] |
| InChI | InChI=1S/C45H30N2/c1-3-16-31(17-4-1)32-18-15-19-33(30-32)43-35-22-7-9-24-37(35)44(38-25-10-8-23-36(38)43)39-26-11-12-27-40(39)45-46-41-28-13-14-29-42(41)47(45)34-20-5-2-6-21-34/h1-30H/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D,16D,17D,20D,21D,22D,23D,24D,25D |
| InChIKey | GHRHRWQXNAOCSD-MSODERNVSA-N |
| XLogP | 12.00 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.86 |
| LogP ≤ 5 | 12.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|