C44H29N3 — CID 169070191
1-(2,3,4,5,6-pentadeuteriophenyl)-2-[2-[10-(3-pyridin-3-ylphenyl)anthracen-9-yl]phenyl]benzimidazole (PubChem CID 169070191) has the molecular formula C44H29N3 and a molecular weight of 604.77 g/mol. Its IUPAC name is 1-(2,3,4,5,6-pentadeuteriophenyl)-2-[2-[10-(3-pyridin-3-ylphenyl)anthracen-9-yl]phenyl]benzimidazole.
| Compound Name | 1-(2,3,4,5,6-pentadeuteriophenyl)-2-[2-[10-(3-pyridin-3-ylphenyl)anthracen-9-yl]phenyl]benzimidazole |
|---|---|
| PubChem CID | 169070191 |
| Molecular Formula | C44H29N3 |
| Molecular Weight | 604.77 g/mol |
| Exact Mass | 604.27 |
| IUPAC Name | 1-(2,3,4,5,6-pentadeuteriophenyl)-2-[2-[10-(3-pyridin-3-ylphenyl)anthracen-9-yl]phenyl]benzimidazole |
| SMILES | [2H]c1c([2H])c([2H])c(-n2c(-c3ccccc3-c3c4ccccc4c(-c4cccc(-c5cccnc5)c4)c4ccccc34)nc3ccccc32)c([2H])c1[2H] |
| InChI | InChI=1S/C44H29N3/c1-2-17-33(18-3-1)47-41-26-11-10-25-40(41)46-44(47)39-24-9-8-23-38(39)43-36-21-6-4-19-34(36)42(35-20-5-7-22-37(35)43)31-15-12-14-30(28-31)32-16-13-27-45-29-32/h1-29H/i1D,2D,3D,17D,18D |
| InChIKey | VVVUNGAYJDDRGS-CXPJANBSSA-N |
| XLogP | 11.39 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.77 |
| LogP ≤ 5 | 11.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|