C34H24N2 — CID 169071319
2-methyl-1-[3-(1,2,3,4,5,6,7,8-octadeuterio-10-phenylanthracen-9-yl)phenyl]benzimidazole (PubChem CID 169071319) has the molecular formula C34H24N2 and a molecular weight of 468.63 g/mol. Its IUPAC name is 2-methyl-1-[3-(1,2,3,4,5,6,7,8-octadeuterio-10-phenylanthracen-9-yl)phenyl]benzimidazole.
| Compound Name | 2-methyl-1-[3-(1,2,3,4,5,6,7,8-octadeuterio-10-phenylanthracen-9-yl)phenyl]benzimidazole |
|---|---|
| PubChem CID | 169071319 |
| Molecular Formula | C34H24N2 |
| Molecular Weight | 468.63 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | 2-methyl-1-[3-(1,2,3,4,5,6,7,8-octadeuterio-10-phenylanthracen-9-yl)phenyl]benzimidazole |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3cccc(-n4c(C)nc5ccccc54)c3)c3c([2H])c([2H])c([2H])c([2H])c3c(-c3ccccc3)c2c1[2H] |
| InChI | InChI=1S/C34H24N2/c1-23-35-31-20-9-10-21-32(31)36(23)26-15-11-14-25(22-26)34-29-18-7-5-16-27(29)33(24-12-3-2-4-13-24)28-17-6-8-19-30(28)34/h2-22H,1H3/i5D,6D,7D,8D,16D,17D,18D,19D |
| InChIKey | ZZSVZDWWSXYNSO-OROYGOIVSA-N |
| XLogP | 8.97 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.63 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|