C37H28N2 — CID 169070739
1-[10-(9,9-dimethylfluoren-2-yl)anthracen-9-yl]-2-(trideuteriomethyl)benzimidazole (PubChem CID 169070739) has the molecular formula C37H28N2 and a molecular weight of 503.66 g/mol. Its IUPAC name is 1-[10-(9,9-dimethylfluoren-2-yl)anthracen-9-yl]-2-(trideuteriomethyl)benzimidazole.
| Compound Name | 1-[10-(9,9-dimethylfluoren-2-yl)anthracen-9-yl]-2-(trideuteriomethyl)benzimidazole |
|---|---|
| PubChem CID | 169070739 |
| Molecular Formula | C37H28N2 |
| Molecular Weight | 503.66 g/mol |
| Exact Mass | 503.24 |
| IUPAC Name | 1-[10-(9,9-dimethylfluoren-2-yl)anthracen-9-yl]-2-(trideuteriomethyl)benzimidazole |
| SMILES | [2H]C([2H])([2H])c1nc2ccccc2n1-c1c2ccccc2c(-c2ccc3c(c2)C(C)(C)c2ccccc2-3)c2ccccc12 |
| InChI | InChI=1S/C37H28N2/c1-23-38-33-18-10-11-19-34(33)39(23)36-29-15-6-4-13-27(29)35(28-14-5-7-16-30(28)36)24-20-21-26-25-12-8-9-17-31(25)37(2,3)32(26)22-24/h4-22H,1-3H3/i1D3 |
| InChIKey | KIQBGTQUAMSECS-FIBGUPNXSA-N |
| XLogP | 9.61 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.66 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|