C34H24N2 — CID 169070200
1-[10-(3-phenylphenyl)anthracen-9-yl]-2-(trideuteriomethyl)benzimidazole (PubChem CID 169070200) has the molecular formula C34H24N2 and a molecular weight of 463.60 g/mol. Its IUPAC name is 1-[10-(3-phenylphenyl)anthracen-9-yl]-2-(trideuteriomethyl)benzimidazole.
| Compound Name | 1-[10-(3-phenylphenyl)anthracen-9-yl]-2-(trideuteriomethyl)benzimidazole |
|---|---|
| PubChem CID | 169070200 |
| Molecular Formula | C34H24N2 |
| Molecular Weight | 463.60 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | 1-[10-(3-phenylphenyl)anthracen-9-yl]-2-(trideuteriomethyl)benzimidazole |
| SMILES | [2H]C([2H])([2H])c1nc2ccccc2n1-c1c2ccccc2c(-c2cccc(-c3ccccc3)c2)c2ccccc12 |
| InChI | InChI=1S/C34H24N2/c1-23-35-31-20-9-10-21-32(31)36(23)34-29-18-7-5-16-27(29)33(28-17-6-8-19-30(28)34)26-15-11-14-25(22-26)24-12-3-2-4-13-24/h2-22H,1H3/i1D3 |
| InChIKey | DPFBTNPFCUHMOL-FIBGUPNXSA-N |
| XLogP | 8.97 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.60 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|