About CID 174119778
CID 174119778 (PubChem CID 174119778) has the molecular formula C35H23B3N2O
and a molecular weight of 520.02 g/mol.
Molecular Properties
| Compound Name | CID 174119778 |
| PubChem CID | 174119778 |
| Molecular Formula | C35H23B3N2O |
| Molecular Weight | 520.02 g/mol |
| Exact Mass | 520.21 |
| IUPAC Name | — |
| SMILES | [B]c1c(C)c([B])c(-c2cccc(-c3c4ccccc4c(-n4c(C)nc5ccccc54)c4ccccc34)c2)c([B])c1O |
| InChI | InChI=1S/C35H23B3N2O/c1-19-31(36)30(33(38)35(41)32(19)37)22-11-9-10-21(18-22)29-23-12-3-5-14-25(23)34(26-15-6-4-13-24(26)29)40-20(2)39-27-16-7-8-17-28(27)40/h3-18,41H,1-2H3 |
| InChIKey | ZXPJFSNBZVLVBA-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 520.02 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze CID 174119778 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174119778?
The IUPAC name of CID 174119778 (CID 174119778) is not available.
What is the SMILES notation for CID 174119778?
The canonical SMILES for CID 174119778 is [B]c1c(C)c([B])c(-c2cccc(-c3c4ccccc4c(-n4c(C)nc5ccccc54)c4ccccc34)c2)c([B])c1O.
What is the InChIKey of CID 174119778?
The InChIKey is ZXPJFSNBZVLVBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C35H23B3N2O/c1-19-31(36)30(33(38)35(41)32(19)37)22-11-9-10-21(18-22)29-23-12-3-5-14-25(23)34(26-15-6-4-13-24(26)29)40-20(2)39-27-16-7-8-17-28(27)40/h3-18,41H,1-2H3.
What are the key properties of CID 174119778?
CID 174119778 has a molecular weight of 520.02 g/mol, XLogP of 5.37, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174119778 is sourced from PubChem (CID 174119778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).