C39H27N3 — CID 169071585
1-[4-[10-(3-pyridin-2-ylphenyl)anthracen-9-yl]phenyl]-2-(trideuteriomethyl)benzimidazole (PubChem CID 169071585) has the molecular formula C39H27N3 and a molecular weight of 540.68 g/mol. Its IUPAC name is 1-[4-[10-(3-pyridin-2-ylphenyl)anthracen-9-yl]phenyl]-2-(trideuteriomethyl)benzimidazole.
| Compound Name | 1-[4-[10-(3-pyridin-2-ylphenyl)anthracen-9-yl]phenyl]-2-(trideuteriomethyl)benzimidazole |
|---|---|
| PubChem CID | 169071585 |
| Molecular Formula | C39H27N3 |
| Molecular Weight | 540.68 g/mol |
| Exact Mass | 540.24 |
| IUPAC Name | 1-[4-[10-(3-pyridin-2-ylphenyl)anthracen-9-yl]phenyl]-2-(trideuteriomethyl)benzimidazole |
| SMILES | [2H]C([2H])([2H])c1nc2ccccc2n1-c1ccc(-c2c3ccccc3c(-c3cccc(-c4ccccn4)c3)c3ccccc23)cc1 |
| InChI | InChI=1S/C39H27N3/c1-26-41-36-18-6-7-19-37(36)42(26)30-22-20-27(21-23-30)38-31-13-2-4-15-33(31)39(34-16-5-3-14-32(34)38)29-12-10-11-28(25-29)35-17-8-9-24-40-35/h2-25H,1H3/i1D3 |
| InChIKey | FXUGDFHHYCKYNG-FIBGUPNXSA-N |
| XLogP | 10.04 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.68 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|