C40H26N2S — CID 169071972
1-[4-(10-dibenzothiophen-2-ylanthracen-9-yl)phenyl]-2-(trideuteriomethyl)benzimidazole (PubChem CID 169071972) has the molecular formula C40H26N2S and a molecular weight of 569.75 g/mol. Its IUPAC name is 1-[4-(10-dibenzothiophen-2-ylanthracen-9-yl)phenyl]-2-(trideuteriomethyl)benzimidazole.
| Compound Name | 1-[4-(10-dibenzothiophen-2-ylanthracen-9-yl)phenyl]-2-(trideuteriomethyl)benzimidazole |
|---|---|
| PubChem CID | 169071972 |
| Molecular Formula | C40H26N2S |
| Molecular Weight | 569.75 g/mol |
| Exact Mass | 569.20 |
| IUPAC Name | 1-[4-(10-dibenzothiophen-2-ylanthracen-9-yl)phenyl]-2-(trideuteriomethyl)benzimidazole |
| SMILES | [2H]C([2H])([2H])c1nc2ccccc2n1-c1ccc(-c2c3ccccc3c(-c3ccc4sc5ccccc5c4c3)c3ccccc23)cc1 |
| InChI | InChI=1S/C40H26N2S/c1-25-41-35-15-7-8-16-36(35)42(25)28-21-18-26(19-22-28)39-30-11-2-4-13-32(30)40(33-14-5-3-12-31(33)39)27-20-23-38-34(24-27)29-10-6-9-17-37(29)43-38/h2-24H,1H3/i1D3 |
| InChIKey | WQMSSSFNSMJXAR-FIBGUPNXSA-N |
| XLogP | 11.34 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.75 |
| LogP ≤ 5 | 11.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|