C53H36N2S — CID 169071770
1-[4-[4-(10-dibenzothiophen-2-yl-3-phenylanthracen-9-yl)phenyl]phenyl]-2-(1,1,2,2,2-pentadeuterioethyl)benzimidazole (PubChem CID 169071770) has the molecular formula C53H36N2S and a molecular weight of 737.98 g/mol. Its IUPAC name is 1-[4-[4-(10-dibenzothiophen-2-yl-3-phenylanthracen-9-yl)phenyl]phenyl]-2-(1,1,2,2,2-pentadeuterioethyl)benzimidazole.
| Compound Name | 1-[4-[4-(10-dibenzothiophen-2-yl-3-phenylanthracen-9-yl)phenyl]phenyl]-2-(1,1,2,2,2-pentadeuterioethyl)benzimidazole |
|---|---|
| PubChem CID | 169071770 |
| Molecular Formula | C53H36N2S |
| Molecular Weight | 737.98 g/mol |
| Exact Mass | 737.29 |
| IUPAC Name | 1-[4-[4-(10-dibenzothiophen-2-yl-3-phenylanthracen-9-yl)phenyl]phenyl]-2-(1,1,2,2,2-pentadeuterioethyl)benzimidazole |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])c1nc2ccccc2n1-c1ccc(-c2ccc(-c3c4ccccc4c(-c4ccc5sc6ccccc6c5c4)c4cc(-c5ccccc5)ccc34)cc2)cc1 |
| InChI | InChI=1S/C53H36N2S/c1-2-51-54-47-17-9-10-18-48(47)55(51)40-28-24-36(25-29-40)35-20-22-37(23-21-35)52-42-15-6-7-16-43(42)53(46-32-38(26-30-44(46)52)34-12-4-3-5-13-34)39-27-31-50-45(33-39)41-14-8-11-19-49(41)56-50/h3-33H,2H2,1H3/i1D3,2D2 |
| InChIKey | APHFQARGPFXKLF-ZBJDZAJPSA-N |
| XLogP | 14.93 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.98 |
| LogP ≤ 5 | 14.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|