C52H36N2 — CID 169072068
2-[4-[10-[9,9-bis(trideuteriomethyl)fluoren-2-yl]anthracen-9-yl]phenyl]-1-naphthalen-2-ylbenzimidazole (PubChem CID 169072068) has the molecular formula C52H36N2 and a molecular weight of 694.91 g/mol. Its IUPAC name is 2-[4-[10-[9,9-bis(trideuteriomethyl)fluoren-2-yl]anthracen-9-yl]phenyl]-1-naphthalen-2-ylbenzimidazole.
| Compound Name | 2-[4-[10-[9,9-bis(trideuteriomethyl)fluoren-2-yl]anthracen-9-yl]phenyl]-1-naphthalen-2-ylbenzimidazole |
|---|---|
| PubChem CID | 169072068 |
| Molecular Formula | C52H36N2 |
| Molecular Weight | 694.91 g/mol |
| Exact Mass | 694.33 |
| IUPAC Name | 2-[4-[10-[9,9-bis(trideuteriomethyl)fluoren-2-yl]anthracen-9-yl]phenyl]-1-naphthalen-2-ylbenzimidazole |
| SMILES | [2H]C([2H])([2H])C1(C([2H])([2H])[2H])c2ccccc2-c2ccc(-c3c4ccccc4c(-c4ccc(-c5nc6ccccc6n5-c5ccc6ccccc6c5)cc4)c4ccccc34)cc21 |
| InChI | InChI=1S/C52H36N2/c1-52(2)45-20-10-9-15-39(45)40-30-28-37(32-46(40)52)50-43-18-7-5-16-41(43)49(42-17-6-8-19-44(42)50)34-23-25-35(26-24-34)51-53-47-21-11-12-22-48(47)54(51)38-29-27-33-13-3-4-14-36(33)31-38/h3-32H,1-2H3/i1D3,2D3 |
| InChIKey | ZTBRNPZZRZBPDI-WFGJKAKNSA-N |
| XLogP | 13.79 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.91 |
| LogP ≤ 5 | 13.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|