C14H16N2O6 — CID 108762117
diethyl 2-[(2-cyanoacetyl)amino]-5-methylfuran-3,4-dicarboxylate (PubChem CID 108762117) has the molecular formula C14H16N2O6 and a molecular weight of 308.29 g/mol. Its IUPAC name is diethyl 2-[(2-cyanoacetyl)amino]-5-methylfuran-3,4-dicarboxylate.
| Compound Name | diethyl 2-[(2-cyanoacetyl)amino]-5-methylfuran-3,4-dicarboxylate |
|---|---|
| PubChem CID | 108762117 |
| Molecular Formula | C14H16N2O6 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | diethyl 2-[(2-cyanoacetyl)amino]-5-methylfuran-3,4-dicarboxylate |
| SMILES | CCOC(=O)c1c(C)oc(NC(=O)CC#N)c1C(=O)OCC |
| InChI | InChI=1S/C14H16N2O6/c1-4-20-13(18)10-8(3)22-12(16-9(17)6-7-15)11(10)14(19)21-5-2/h4-6H2,1-3H3,(H,16,17) |
| InChIKey | MWUQWVOONIYIIH-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 118.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |