C18H26N2O6 — CID 108782631
diethyl 2-(cyclohexylcarbamoylamino)-5-methylfuran-3,4-dicarboxylate (PubChem CID 108782631) has the molecular formula C18H26N2O6 and a molecular weight of 366.41 g/mol. Its IUPAC name is diethyl 2-(cyclohexylcarbamoylamino)-5-methylfuran-3,4-dicarboxylate.
| Compound Name | diethyl 2-(cyclohexylcarbamoylamino)-5-methylfuran-3,4-dicarboxylate |
|---|---|
| PubChem CID | 108782631 |
| Molecular Formula | C18H26N2O6 |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | diethyl 2-(cyclohexylcarbamoylamino)-5-methylfuran-3,4-dicarboxylate |
| SMILES | CCOC(=O)c1c(C)oc(NC(=O)NC2CCCCC2)c1C(=O)OCC |
| InChI | InChI=1S/C18H26N2O6/c1-4-24-16(21)13-11(3)26-15(14(13)17(22)25-5-2)20-18(23)19-12-9-7-6-8-10-12/h12H,4-10H2,1-3H3,(H2,19,20,23) |
| InChIKey | UBVCXTGOYMQQMK-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |