C17H24N2O4S — CID 108782926
ethyl 4-acetyl-2-(cyclohexylcarbamothioylamino)-5-methylfuran-3-carboxylate (PubChem CID 108782926) has the molecular formula C17H24N2O4S and a molecular weight of 352.46 g/mol. Its IUPAC name is ethyl 4-acetyl-2-(cyclohexylcarbamothioylamino)-5-methylfuran-3-carboxylate.
| Compound Name | ethyl 4-acetyl-2-(cyclohexylcarbamothioylamino)-5-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 108782926 |
| Molecular Formula | C17H24N2O4S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | ethyl 4-acetyl-2-(cyclohexylcarbamothioylamino)-5-methylfuran-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=S)NC2CCCCC2)oc(C)c1C(C)=O |
| InChI | InChI=1S/C17H24N2O4S/c1-4-22-16(21)14-13(10(2)20)11(3)23-15(14)19-17(24)18-12-8-6-5-7-9-12/h12H,4-9H2,1-3H3,(H2,18,19,24) |
| InChIKey | VPDKOEDBQYAUPM-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|