C18H26N2O5 — CID 8557699
ethyl 4-acetyl-5-methyl-2-[[2-(4-methylpiperidin-1-yl)acetyl]amino]furan-3-carboxylate (PubChem CID 8557699) has the molecular formula C18H26N2O5 and a molecular weight of 350.42 g/mol. Its IUPAC name is ethyl 4-acetyl-5-methyl-2-[[2-(4-methylpiperidin-1-yl)acetyl]amino]furan-3-carboxylate.
| Compound Name | ethyl 4-acetyl-5-methyl-2-[[2-(4-methylpiperidin-1-yl)acetyl]amino]furan-3-carboxylate |
|---|---|
| PubChem CID | 8557699 |
| Molecular Formula | C18H26N2O5 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | ethyl 4-acetyl-5-methyl-2-[[2-(4-methylpiperidin-1-yl)acetyl]amino]furan-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CN2CCC(C)CC2)oc(C)c1C(C)=O |
| InChI | InChI=1S/C18H26N2O5/c1-5-24-18(23)16-15(12(3)21)13(4)25-17(16)19-14(22)10-20-8-6-11(2)7-9-20/h11H,5-10H2,1-4H3,(H,19,22) |
| InChIKey | FCPVYDDVPCIUPG-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |