C18H24N2O6 — CID 108741022
ethyl 4-acetyl-2-[(1-acetylpiperidine-4-carbonyl)amino]-5-methylfuran-3-carboxylate (PubChem CID 108741022) has the molecular formula C18H24N2O6 and a molecular weight of 364.40 g/mol. Its IUPAC name is ethyl 4-acetyl-2-[(1-acetylpiperidine-4-carbonyl)amino]-5-methylfuran-3-carboxylate.
| Compound Name | ethyl 4-acetyl-2-[(1-acetylpiperidine-4-carbonyl)amino]-5-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 108741022 |
| Molecular Formula | C18H24N2O6 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | ethyl 4-acetyl-2-[(1-acetylpiperidine-4-carbonyl)amino]-5-methylfuran-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C2CCN(C(C)=O)CC2)oc(C)c1C(C)=O |
| InChI | InChI=1S/C18H24N2O6/c1-5-25-18(24)15-14(10(2)21)11(3)26-17(15)19-16(23)13-6-8-20(9-7-13)12(4)22/h13H,5-9H2,1-4H3,(H,19,23) |
| InChIKey | TVEVEJDNGJICCB-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |