C17H23N3O6 — CID 108733749
ethyl 5-[(1-acetylpiperidine-4-carbonyl)amino]-4-carbamoyl-2-methylfuran-3-carboxylate (PubChem CID 108733749) has the molecular formula C17H23N3O6 and a molecular weight of 365.39 g/mol. Its IUPAC name is ethyl 5-[(1-acetylpiperidine-4-carbonyl)amino]-4-carbamoyl-2-methylfuran-3-carboxylate.
| Compound Name | ethyl 5-[(1-acetylpiperidine-4-carbonyl)amino]-4-carbamoyl-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 108733749 |
| Molecular Formula | C17H23N3O6 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | ethyl 5-[(1-acetylpiperidine-4-carbonyl)amino]-4-carbamoyl-2-methylfuran-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)oc(NC(=O)C2CCN(C(C)=O)CC2)c1C(N)=O |
| InChI | InChI=1S/C17H23N3O6/c1-4-25-17(24)12-9(2)26-16(13(12)14(18)22)19-15(23)11-5-7-20(8-6-11)10(3)21/h11H,4-8H2,1-3H3,(H2,18,22)(H,19,23) |
| InChIKey | NKPDOXNJGHTZPS-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 131.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |