C20H23NO6 — CID 108802798
ethyl 4-acetyl-5-methyl-2-[3-(4-methylphenoxy)propanoylamino]furan-3-carboxylate (PubChem CID 108802798) has the molecular formula C20H23NO6 and a molecular weight of 373.41 g/mol. Its IUPAC name is ethyl 4-acetyl-5-methyl-2-[3-(4-methylphenoxy)propanoylamino]furan-3-carboxylate.
| Compound Name | ethyl 4-acetyl-5-methyl-2-[3-(4-methylphenoxy)propanoylamino]furan-3-carboxylate |
|---|---|
| PubChem CID | 108802798 |
| Molecular Formula | C20H23NO6 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | ethyl 4-acetyl-5-methyl-2-[3-(4-methylphenoxy)propanoylamino]furan-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CCOc2ccc(C)cc2)oc(C)c1C(C)=O |
| InChI | InChI=1S/C20H23NO6/c1-5-25-20(24)18-17(13(3)22)14(4)27-19(18)21-16(23)10-11-26-15-8-6-12(2)7-9-15/h6-9H,5,10-11H2,1-4H3,(H,21,23) |
| InChIKey | SHCIHAQGYPEJLR-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |