C21H25NO7 — CID 108763637
ethyl 4-acetyl-2-[4-(4-methoxyphenoxy)butanoylamino]-5-methylfuran-3-carboxylate (PubChem CID 108763637) has the molecular formula C21H25NO7 and a molecular weight of 403.43 g/mol. Its IUPAC name is ethyl 4-acetyl-2-[4-(4-methoxyphenoxy)butanoylamino]-5-methylfuran-3-carboxylate.
| Compound Name | ethyl 4-acetyl-2-[4-(4-methoxyphenoxy)butanoylamino]-5-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 108763637 |
| Molecular Formula | C21H25NO7 |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | ethyl 4-acetyl-2-[4-(4-methoxyphenoxy)butanoylamino]-5-methylfuran-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CCCOc2ccc(OC)cc2)oc(C)c1C(C)=O |
| InChI | InChI=1S/C21H25NO7/c1-5-27-21(25)19-18(13(2)23)14(3)29-20(19)22-17(24)7-6-12-28-16-10-8-15(26-4)9-11-16/h8-11H,5-7,12H2,1-4H3,(H,22,24) |
| InChIKey | PKBRJANBAUWTHI-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 104.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|