C23H22N2O8 — CID 43032614
ethyl 4-acetyl-2-[[2-[(E)-2-cyano-3-(4-methoxyphenyl)prop-2-enoyl]oxyacetyl]amino]-5-methylfuran-3-carboxylate (PubChem CID 43032614) has the molecular formula C23H22N2O8 and a molecular weight of 454.44 g/mol. Its IUPAC name is ethyl 4-acetyl-2-[[2-[(E)-2-cyano-3-(4-methoxyphenyl)prop-2-enoyl]oxyacetyl]amino]-5-methylfuran-3-carboxylate.
| Compound Name | ethyl 4-acetyl-2-[[2-[(E)-2-cyano-3-(4-methoxyphenyl)prop-2-enoyl]oxyacetyl]amino]-5-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 43032614 |
| Molecular Formula | C23H22N2O8 |
| Molecular Weight | 454.44 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | ethyl 4-acetyl-2-[[2-[(E)-2-cyano-3-(4-methoxyphenyl)prop-2-enoyl]oxyacetyl]amino]-5-methylfuran-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)COC(=O)/C(C#N)=C/c2ccc(OC)cc2)oc(C)c1C(C)=O |
| InChI | InChI=1S/C23H22N2O8/c1-5-31-23(29)20-19(13(2)26)14(3)33-21(20)25-18(27)12-32-22(28)16(11-24)10-15-6-8-17(30-4)9-7-15/h6-10H,5,12H2,1-4H3,(H,25,27)/b16-10+ |
| InChIKey | FNJYKEPAVFHUNG-MHWRWJLKSA-N |
| XLogP | 3.06 |
| TPSA | 144.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.44 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|