C22H23NO7 — CID 7715496
ethyl 4-acetyl-5-methyl-2-[[2-[(E)-3-(4-methylphenyl)prop-2-enoyl]oxyacetyl]amino]furan-3-carboxylate (PubChem CID 7715496) has the molecular formula C22H23NO7 and a molecular weight of 413.43 g/mol. Its IUPAC name is ethyl 4-acetyl-5-methyl-2-[[2-[(E)-3-(4-methylphenyl)prop-2-enoyl]oxyacetyl]amino]furan-3-carboxylate.
| Compound Name | ethyl 4-acetyl-5-methyl-2-[[2-[(E)-3-(4-methylphenyl)prop-2-enoyl]oxyacetyl]amino]furan-3-carboxylate |
|---|---|
| PubChem CID | 7715496 |
| Molecular Formula | C22H23NO7 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | ethyl 4-acetyl-5-methyl-2-[[2-[(E)-3-(4-methylphenyl)prop-2-enoyl]oxyacetyl]amino]furan-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)COC(=O)/C=C/c2ccc(C)cc2)oc(C)c1C(C)=O |
| InChI | InChI=1S/C22H23NO7/c1-5-28-22(27)20-19(14(3)24)15(4)30-21(20)23-17(25)12-29-18(26)11-10-16-8-6-13(2)7-9-16/h6-11H,5,12H2,1-4H3,(H,23,25)/b11-10+ |
| InChIKey | XZGAMJOOPLYOSE-ZHACJKMWSA-N |
| XLogP | 3.47 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|