C19H18FNO7 — CID 18194760
ethyl 4-acetyl-2-[[2-(3-fluorobenzoyl)oxyacetyl]amino]-5-methylfuran-3-carboxylate (PubChem CID 18194760) has the molecular formula C19H18FNO7 and a molecular weight of 391.35 g/mol. Its IUPAC name is ethyl 4-acetyl-2-[[2-(3-fluorobenzoyl)oxyacetyl]amino]-5-methylfuran-3-carboxylate.
| Compound Name | ethyl 4-acetyl-2-[[2-(3-fluorobenzoyl)oxyacetyl]amino]-5-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 18194760 |
| Molecular Formula | C19H18FNO7 |
| Molecular Weight | 391.35 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | ethyl 4-acetyl-2-[[2-(3-fluorobenzoyl)oxyacetyl]amino]-5-methylfuran-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)COC(=O)c2cccc(F)c2)oc(C)c1C(C)=O |
| InChI | InChI=1S/C19H18FNO7/c1-4-26-19(25)16-15(10(2)22)11(3)28-17(16)21-14(23)9-27-18(24)12-6-5-7-13(20)8-12/h5-8H,4,9H2,1-3H3,(H,21,23) |
| InChIKey | YREPQEDJFZEXIH-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.35 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |