C17H16FNO5 — CID 108740989
ethyl 4-acetyl-2-[(3-fluorobenzoyl)amino]-5-methylfuran-3-carboxylate (PubChem CID 108740989) has the molecular formula C17H16FNO5 and a molecular weight of 333.31 g/mol. Its IUPAC name is ethyl 4-acetyl-2-[(3-fluorobenzoyl)amino]-5-methylfuran-3-carboxylate.
| Compound Name | ethyl 4-acetyl-2-[(3-fluorobenzoyl)amino]-5-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 108740989 |
| Molecular Formula | C17H16FNO5 |
| Molecular Weight | 333.31 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | ethyl 4-acetyl-2-[(3-fluorobenzoyl)amino]-5-methylfuran-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)c2cccc(F)c2)oc(C)c1C(C)=O |
| InChI | InChI=1S/C17H16FNO5/c1-4-23-17(22)14-13(9(2)20)10(3)24-16(14)19-15(21)11-6-5-7-12(18)8-11/h5-8H,4H2,1-3H3,(H,19,21) |
| InChIKey | LNPWLJUBTDSLHX-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.31 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |