C19H22N2O5 — CID 108740607
4-acetyl-5-methyl-2-[[3-(2-methylpropoxy)benzoyl]amino]furan-3-carboxamide (PubChem CID 108740607) has the molecular formula C19H22N2O5 and a molecular weight of 358.39 g/mol. Its IUPAC name is 4-acetyl-5-methyl-2-[[3-(2-methylpropoxy)benzoyl]amino]furan-3-carboxamide.
| Compound Name | 4-acetyl-5-methyl-2-[[3-(2-methylpropoxy)benzoyl]amino]furan-3-carboxamide |
|---|---|
| PubChem CID | 108740607 |
| Molecular Formula | C19H22N2O5 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 4-acetyl-5-methyl-2-[[3-(2-methylpropoxy)benzoyl]amino]furan-3-carboxamide |
| SMILES | CC(=O)c1c(C)oc(NC(=O)c2cccc(OCC(C)C)c2)c1C(N)=O |
| InChI | InChI=1S/C19H22N2O5/c1-10(2)9-25-14-7-5-6-13(8-14)18(24)21-19-16(17(20)23)15(11(3)22)12(4)26-19/h5-8,10H,9H2,1-4H3,(H2,20,23)(H,21,24) |
| InChIKey | RSEPMQPDQBIKGD-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |