C20H23NO8 — CID 108762112
diethyl 2-[(2,6-dimethoxybenzoyl)amino]-5-methylfuran-3,4-dicarboxylate (PubChem CID 108762112) has the molecular formula C20H23NO8 and a molecular weight of 405.40 g/mol. Its IUPAC name is diethyl 2-[(2,6-dimethoxybenzoyl)amino]-5-methylfuran-3,4-dicarboxylate.
| Compound Name | diethyl 2-[(2,6-dimethoxybenzoyl)amino]-5-methylfuran-3,4-dicarboxylate |
|---|---|
| PubChem CID | 108762112 |
| Molecular Formula | C20H23NO8 |
| Molecular Weight | 405.40 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | diethyl 2-[(2,6-dimethoxybenzoyl)amino]-5-methylfuran-3,4-dicarboxylate |
| SMILES | CCOC(=O)c1c(C)oc(NC(=O)c2c(OC)cccc2OC)c1C(=O)OCC |
| InChI | InChI=1S/C20H23NO8/c1-6-27-19(23)14-11(3)29-18(16(14)20(24)28-7-2)21-17(22)15-12(25-4)9-8-10-13(15)26-5/h8-10H,6-7H2,1-5H3,(H,21,22) |
| InChIKey | IGZSPXWCCFXUKQ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 113.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |