C17H18N2O6 — CID 108763231
4-acetyl-2-[(2,6-dimethoxybenzoyl)amino]-5-methylfuran-3-carboxamide (PubChem CID 108763231) has the molecular formula C17H18N2O6 and a molecular weight of 346.34 g/mol. Its IUPAC name is 4-acetyl-2-[(2,6-dimethoxybenzoyl)amino]-5-methylfuran-3-carboxamide.
| Compound Name | 4-acetyl-2-[(2,6-dimethoxybenzoyl)amino]-5-methylfuran-3-carboxamide |
|---|---|
| PubChem CID | 108763231 |
| Molecular Formula | C17H18N2O6 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 4-acetyl-2-[(2,6-dimethoxybenzoyl)amino]-5-methylfuran-3-carboxamide |
| SMILES | COc1cccc(OC)c1C(=O)Nc1oc(C)c(C(C)=O)c1C(N)=O |
| InChI | InChI=1S/C17H18N2O6/c1-8(20)12-9(2)25-17(14(12)15(18)21)19-16(22)13-10(23-3)6-5-7-11(13)24-4/h5-7H,1-4H3,(H2,18,21)(H,19,22) |
| InChIKey | MBJSFVKKMCVAPB-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 120.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |