C13H18N2O6 — CID 108740663
4-acetyl-2-[[2-(2-methoxyethoxy)acetyl]amino]-5-methylfuran-3-carboxamide (PubChem CID 108740663) has the molecular formula C13H18N2O6 and a molecular weight of 298.30 g/mol. Its IUPAC name is 4-acetyl-2-[[2-(2-methoxyethoxy)acetyl]amino]-5-methylfuran-3-carboxamide.
| Compound Name | 4-acetyl-2-[[2-(2-methoxyethoxy)acetyl]amino]-5-methylfuran-3-carboxamide |
|---|---|
| PubChem CID | 108740663 |
| Molecular Formula | C13H18N2O6 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 4-acetyl-2-[[2-(2-methoxyethoxy)acetyl]amino]-5-methylfuran-3-carboxamide |
| SMILES | COCCOCC(=O)Nc1oc(C)c(C(C)=O)c1C(N)=O |
| InChI | InChI=1S/C13H18N2O6/c1-7(16)10-8(2)21-13(11(10)12(14)18)15-9(17)6-20-5-4-19-3/h4-6H2,1-3H3,(H2,14,18)(H,15,17) |
| InChIKey | OTLZEJBPQOESNE-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 120.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|