C22H25NO8 — CID 108762216
diethyl 2-[[(E)-3-(2,5-dimethoxyphenyl)prop-2-enoyl]amino]-5-methylfuran-3,4-dicarboxylate (PubChem CID 108762216) has the molecular formula C22H25NO8 and a molecular weight of 431.44 g/mol. Its IUPAC name is diethyl 2-[[(E)-3-(2,5-dimethoxyphenyl)prop-2-enoyl]amino]-5-methylfuran-3,4-dicarboxylate.
| Compound Name | diethyl 2-[[(E)-3-(2,5-dimethoxyphenyl)prop-2-enoyl]amino]-5-methylfuran-3,4-dicarboxylate |
|---|---|
| PubChem CID | 108762216 |
| Molecular Formula | C22H25NO8 |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | diethyl 2-[[(E)-3-(2,5-dimethoxyphenyl)prop-2-enoyl]amino]-5-methylfuran-3,4-dicarboxylate |
| SMILES | CCOC(=O)c1c(C)oc(NC(=O)/C=C/c2cc(OC)ccc2OC)c1C(=O)OCC |
| InChI | InChI=1S/C22H25NO8/c1-6-29-21(25)18-13(3)31-20(19(18)22(26)30-7-2)23-17(24)11-8-14-12-15(27-4)9-10-16(14)28-5/h8-12H,6-7H2,1-5H3,(H,23,24)/b11-8+ |
| InChIKey | VDQBETRASINHSJ-DHZHZOJOSA-N |
| XLogP | 3.61 |
| TPSA | 113.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|