C22H23NO8 — CID 108763594
ethyl 4-acetyl-2-[[(E)-3-(4-acetyloxy-3-methoxyphenyl)prop-2-enoyl]amino]-5-methylfuran-3-carboxylate (PubChem CID 108763594) has the molecular formula C22H23NO8 and a molecular weight of 429.43 g/mol. Its IUPAC name is ethyl 4-acetyl-2-[[(E)-3-(4-acetyloxy-3-methoxyphenyl)prop-2-enoyl]amino]-5-methylfuran-3-carboxylate.
| Compound Name | ethyl 4-acetyl-2-[[(E)-3-(4-acetyloxy-3-methoxyphenyl)prop-2-enoyl]amino]-5-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 108763594 |
| Molecular Formula | C22H23NO8 |
| Molecular Weight | 429.43 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | ethyl 4-acetyl-2-[[(E)-3-(4-acetyloxy-3-methoxyphenyl)prop-2-enoyl]amino]-5-methylfuran-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)/C=C/c2ccc(OC(C)=O)c(OC)c2)oc(C)c1C(C)=O |
| InChI | InChI=1S/C22H23NO8/c1-6-29-22(27)20-19(12(2)24)13(3)30-21(20)23-18(26)10-8-15-7-9-16(31-14(4)25)17(11-15)28-5/h7-11H,6H2,1-5H3,(H,23,26)/b10-8+ |
| InChIKey | MCDVEMQJJMEKFW-CSKARUKUSA-N |
| XLogP | 3.55 |
| TPSA | 121.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.43 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|