C19H19N3O7 — CID 70434982
ethyl 5-[3-(3,4-diacetyloxyphenyl)prop-2-enoylamino]-1H-pyrazole-4-carboxylate (PubChem CID 70434982) has the molecular formula C19H19N3O7 and a molecular weight of 401.38 g/mol. Its IUPAC name is ethyl 5-[3-(3,4-diacetyloxyphenyl)prop-2-enoylamino]-1H-pyrazole-4-carboxylate.
| Compound Name | ethyl 5-[3-(3,4-diacetyloxyphenyl)prop-2-enoylamino]-1H-pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 70434982 |
| Molecular Formula | C19H19N3O7 |
| Molecular Weight | 401.38 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | ethyl 5-[3-(3,4-diacetyloxyphenyl)prop-2-enoylamino]-1H-pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn[nH]c1NC(=O)C=Cc1ccc(OC(C)=O)c(OC(C)=O)c1 |
| InChI | InChI=1S/C19H19N3O7/c1-4-27-19(26)14-10-20-22-18(14)21-17(25)8-6-13-5-7-15(28-11(2)23)16(9-13)29-12(3)24/h5-10H,4H2,1-3H3,(H2,20,21,22,25) |
| InChIKey | RTTVFKPYBZBKNS-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.38 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|