C24H21ClN2O7 — CID 108765277
ethyl 5-[[(E)-3-(4-acetyloxy-3-methoxyphenyl)prop-2-enoyl]amino]-3-(4-chlorophenyl)-1,2-oxazole-4-carboxylate (PubChem CID 108765277) has the molecular formula C24H21ClN2O7 and a molecular weight of 484.89 g/mol. Its IUPAC name is ethyl 5-[[(E)-3-(4-acetyloxy-3-methoxyphenyl)prop-2-enoyl]amino]-3-(4-chlorophenyl)-1,2-oxazole-4-carboxylate.
| Compound Name | ethyl 5-[[(E)-3-(4-acetyloxy-3-methoxyphenyl)prop-2-enoyl]amino]-3-(4-chlorophenyl)-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 108765277 |
| Molecular Formula | C24H21ClN2O7 |
| Molecular Weight | 484.89 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | ethyl 5-[[(E)-3-(4-acetyloxy-3-methoxyphenyl)prop-2-enoyl]amino]-3-(4-chlorophenyl)-1,2-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(Cl)cc2)noc1NC(=O)/C=C/c1ccc(OC(C)=O)c(OC)c1 |
| InChI | InChI=1S/C24H21ClN2O7/c1-4-32-24(30)21-22(16-7-9-17(25)10-8-16)27-34-23(21)26-20(29)12-6-15-5-11-18(33-14(2)28)19(13-15)31-3/h5-13H,4H2,1-3H3,(H,26,29)/b12-6+ |
| InChIKey | GZNKBAUQMIPQAP-WUXMJOGZSA-N |
| XLogP | 4.76 |
| TPSA | 116.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.89 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|