C16H15ClN2O4 — CID 108765205
ethyl 5-[[(E)-but-2-enoyl]amino]-3-(4-chlorophenyl)-1,2-oxazole-4-carboxylate (PubChem CID 108765205) has the molecular formula C16H15ClN2O4 and a molecular weight of 334.76 g/mol. Its IUPAC name is ethyl 5-[[(E)-but-2-enoyl]amino]-3-(4-chlorophenyl)-1,2-oxazole-4-carboxylate.
| Compound Name | ethyl 5-[[(E)-but-2-enoyl]amino]-3-(4-chlorophenyl)-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 108765205 |
| Molecular Formula | C16H15ClN2O4 |
| Molecular Weight | 334.76 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | ethyl 5-[[(E)-but-2-enoyl]amino]-3-(4-chlorophenyl)-1,2-oxazole-4-carboxylate |
| SMILES | C/C=C/C(=O)Nc1onc(-c2ccc(Cl)cc2)c1C(=O)OCC |
| InChI | InChI=1S/C16H15ClN2O4/c1-3-5-12(20)18-15-13(16(21)22-4-2)14(19-23-15)10-6-8-11(17)9-7-10/h3,5-9H,4H2,1-2H3,(H,18,20)/b5-3+ |
| InChIKey | UIFKZHWYLYNXOH-HWKANZROSA-N |
| XLogP | 3.69 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.76 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|