C23H23ClN2O5 — CID 108765301
ethyl 3-(4-chlorophenyl)-5-[4-(4-methylphenoxy)butanoylamino]-1,2-oxazole-4-carboxylate (PubChem CID 108765301) has the molecular formula C23H23ClN2O5 and a molecular weight of 442.90 g/mol. Its IUPAC name is ethyl 3-(4-chlorophenyl)-5-[4-(4-methylphenoxy)butanoylamino]-1,2-oxazole-4-carboxylate.
| Compound Name | ethyl 3-(4-chlorophenyl)-5-[4-(4-methylphenoxy)butanoylamino]-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 108765301 |
| Molecular Formula | C23H23ClN2O5 |
| Molecular Weight | 442.90 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | ethyl 3-(4-chlorophenyl)-5-[4-(4-methylphenoxy)butanoylamino]-1,2-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(Cl)cc2)noc1NC(=O)CCCOc1ccc(C)cc1 |
| InChI | InChI=1S/C23H23ClN2O5/c1-3-29-23(28)20-21(16-8-10-17(24)11-9-16)26-31-22(20)25-19(27)5-4-14-30-18-12-6-15(2)7-13-18/h6-13H,3-5,14H2,1-2H3,(H,25,27) |
| InChIKey | OFFAUMZENNXNOA-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.90 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|