About ethyl 5-[(4-butylcyclohexanecarbonyl)amino]-3-(4-chlorophenyl)-1,2-oxazole-4-carboxylate
ethyl 5-[(4-butylcyclohexanecarbonyl)amino]-3-(4-chlorophenyl)-1,2-oxazole-4-carboxylate (PubChem CID 108742814) has the molecular formula C23H29ClN2O4
and a molecular weight of 432.95 g/mol. Its IUPAC name is ethyl 5-[(4-butylcyclohexanecarbonyl)amino]-3-(4-chlorophenyl)-1,2-oxazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-[(4-butylcyclohexanecarbonyl)amino]-3-(4-chlorophenyl)-1,2-oxazole-4-carboxylate |
| PubChem CID | 108742814 |
| Molecular Formula | C23H29ClN2O4 |
| Molecular Weight | 432.95 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | ethyl 5-[(4-butylcyclohexanecarbonyl)amino]-3-(4-chlorophenyl)-1,2-oxazole-4-carboxylate |
| SMILES | CCCCC1CCC(C(=O)Nc2onc(-c3ccc(Cl)cc3)c2C(=O)OCC)CC1 |
| InChI | InChI=1S/C23H29ClN2O4/c1-3-5-6-15-7-9-17(10-8-15)21(27)25-22-19(23(28)29-4-2)20(26-30-22)16-11-13-18(24)14-12-16/h11-15,17H,3-10H2,1-2H3,(H,25,27) |
| InChIKey | FASVCPHQDSKVAD-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.95 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 5-[(4-butylcyclohexanecarbonyl)amino]-3-(4-chlorophenyl)-1,2-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-[(4-butylcyclohexanecarbonyl)amino]-3-(4-chlorophenyl)-1,2-oxazole-4-carboxylate?
The IUPAC name of ethyl 5-[(4-butylcyclohexanecarbonyl)amino]-3-(4-chlorophenyl)-1,2-oxazole-4-carboxylate (CID 108742814) is ethyl 5-[(4-butylcyclohexanecarbonyl)amino]-3-(4-chlorophenyl)-1,2-oxazole-4-carboxylate.
What is the SMILES notation for ethyl 5-[(4-butylcyclohexanecarbonyl)amino]-3-(4-chlorophenyl)-1,2-oxazole-4-carboxylate?
The canonical SMILES for ethyl 5-[(4-butylcyclohexanecarbonyl)amino]-3-(4-chlorophenyl)-1,2-oxazole-4-carboxylate is CCCCC1CCC(C(=O)Nc2onc(-c3ccc(Cl)cc3)c2C(=O)OCC)CC1.
What is the InChIKey of ethyl 5-[(4-butylcyclohexanecarbonyl)amino]-3-(4-chlorophenyl)-1,2-oxazole-4-carboxylate?
The InChIKey is FASVCPHQDSKVAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H29ClN2O4/c1-3-5-6-15-7-9-17(10-8-15)21(27)25-22-19(23(28)29-4-2)20(26-30-22)16-11-13-18(24)14-12-16/h11-15,17H,3-10H2,1-2H3,(H,25,27).
What are the key properties of ethyl 5-[(4-butylcyclohexanecarbonyl)amino]-3-(4-chlorophenyl)-1,2-oxazole-4-carboxylate?
ethyl 5-[(4-butylcyclohexanecarbonyl)amino]-3-(4-chlorophenyl)-1,2-oxazole-4-carboxylate has a molecular weight of 432.95 g/mol, XLogP of 6.11, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-[(4-butylcyclohexanecarbonyl)amino]-3-(4-chlorophenyl)-1,2-oxazole-4-carboxylate is sourced from PubChem (CID 108742814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).