C21H16Cl2N2O4 — CID 108765260
ethyl 3-(4-chlorophenyl)-5-[[(E)-3-(3-chlorophenyl)prop-2-enoyl]amino]-1,2-oxazole-4-carboxylate (PubChem CID 108765260) has the molecular formula C21H16Cl2N2O4 and a molecular weight of 431.28 g/mol. Its IUPAC name is ethyl 3-(4-chlorophenyl)-5-[[(E)-3-(3-chlorophenyl)prop-2-enoyl]amino]-1,2-oxazole-4-carboxylate.
| Compound Name | ethyl 3-(4-chlorophenyl)-5-[[(E)-3-(3-chlorophenyl)prop-2-enoyl]amino]-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 108765260 |
| Molecular Formula | C21H16Cl2N2O4 |
| Molecular Weight | 431.28 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | ethyl 3-(4-chlorophenyl)-5-[[(E)-3-(3-chlorophenyl)prop-2-enoyl]amino]-1,2-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(Cl)cc2)noc1NC(=O)/C=C/c1cccc(Cl)c1 |
| InChI | InChI=1S/C21H16Cl2N2O4/c1-2-28-21(27)18-19(14-7-9-15(22)10-8-14)25-29-20(18)24-17(26)11-6-13-4-3-5-16(23)12-13/h3-12H,2H2,1H3,(H,24,26)/b11-6+ |
| InChIKey | QXYLKAYXFJFMRM-IZZDOVSWSA-N |
| XLogP | 5.48 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.28 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|