C22H25NO8 — CID 108763592
ethyl 4-acetyl-5-methyl-2-[[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]furan-3-carboxylate (PubChem CID 108763592) has the molecular formula C22H25NO8 and a molecular weight of 431.44 g/mol. Its IUPAC name is ethyl 4-acetyl-5-methyl-2-[[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]furan-3-carboxylate.
| Compound Name | ethyl 4-acetyl-5-methyl-2-[[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]furan-3-carboxylate |
|---|---|
| PubChem CID | 108763592 |
| Molecular Formula | C22H25NO8 |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | ethyl 4-acetyl-5-methyl-2-[[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]furan-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)/C=C/c2cc(OC)c(OC)c(OC)c2)oc(C)c1C(C)=O |
| InChI | InChI=1S/C22H25NO8/c1-7-30-22(26)19-18(12(2)24)13(3)31-21(19)23-17(25)9-8-14-10-15(27-4)20(29-6)16(11-14)28-5/h8-11H,7H2,1-6H3,(H,23,25)/b9-8+ |
| InChIKey | CYLHCBZSBVMMPJ-CMDGGOBGSA-N |
| XLogP | 3.65 |
| TPSA | 113.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|