C13H14Cl3NO6 — CID 108739417
diethyl 2-methyl-5-[(2,2,2-trichloroacetyl)amino]furan-3,4-dicarboxylate (PubChem CID 108739417) has the molecular formula C13H14Cl3NO6 and a molecular weight of 386.62 g/mol. Its IUPAC name is diethyl 2-methyl-5-[(2,2,2-trichloroacetyl)amino]furan-3,4-dicarboxylate.
| Compound Name | diethyl 2-methyl-5-[(2,2,2-trichloroacetyl)amino]furan-3,4-dicarboxylate |
|---|---|
| PubChem CID | 108739417 |
| Molecular Formula | C13H14Cl3NO6 |
| Molecular Weight | 386.62 g/mol |
| Exact Mass | 384.99 |
| IUPAC Name | diethyl 2-methyl-5-[(2,2,2-trichloroacetyl)amino]furan-3,4-dicarboxylate |
| SMILES | CCOC(=O)c1c(C)oc(NC(=O)C(Cl)(Cl)Cl)c1C(=O)OCC |
| InChI | InChI=1S/C13H14Cl3NO6/c1-4-21-10(18)7-6(3)23-9(8(7)11(19)22-5-2)17-12(20)13(14,15)16/h4-5H2,1-3H3,(H,17,20) |
| InChIKey | MWHFLXMYUZLXTL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.62 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|