C20H31NO7 — CID 108739457
diethyl 2-(2-ethylhexoxycarbonylamino)-5-methylfuran-3,4-dicarboxylate (PubChem CID 108739457) has the molecular formula C20H31NO7 and a molecular weight of 397.47 g/mol. Its IUPAC name is diethyl 2-(2-ethylhexoxycarbonylamino)-5-methylfuran-3,4-dicarboxylate.
| Compound Name | diethyl 2-(2-ethylhexoxycarbonylamino)-5-methylfuran-3,4-dicarboxylate |
|---|---|
| PubChem CID | 108739457 |
| Molecular Formula | C20H31NO7 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | diethyl 2-(2-ethylhexoxycarbonylamino)-5-methylfuran-3,4-dicarboxylate |
| SMILES | CCCCC(CC)COC(=O)Nc1oc(C)c(C(=O)OCC)c1C(=O)OCC |
| InChI | InChI=1S/C20H31NO7/c1-6-10-11-14(7-2)12-27-20(24)21-17-16(19(23)26-9-4)15(13(5)28-17)18(22)25-8-3/h14H,6-12H2,1-5H3,(H,21,24) |
| InChIKey | UJYJMPSAQFZYJV-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 104.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|