C19H21NO6 — CID 108739398
diethyl 2-methyl-5-[(3-methylbenzoyl)amino]furan-3,4-dicarboxylate (PubChem CID 108739398) has the molecular formula C19H21NO6 and a molecular weight of 359.38 g/mol. Its IUPAC name is diethyl 2-methyl-5-[(3-methylbenzoyl)amino]furan-3,4-dicarboxylate.
| Compound Name | diethyl 2-methyl-5-[(3-methylbenzoyl)amino]furan-3,4-dicarboxylate |
|---|---|
| PubChem CID | 108739398 |
| Molecular Formula | C19H21NO6 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | diethyl 2-methyl-5-[(3-methylbenzoyl)amino]furan-3,4-dicarboxylate |
| SMILES | CCOC(=O)c1c(C)oc(NC(=O)c2cccc(C)c2)c1C(=O)OCC |
| InChI | InChI=1S/C19H21NO6/c1-5-24-18(22)14-12(4)26-17(15(14)19(23)25-6-2)20-16(21)13-9-7-8-11(3)10-13/h7-10H,5-6H2,1-4H3,(H,20,21) |
| InChIKey | OECWBTDTDFXSRS-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |