C24H25NO6 — CID 108763630
ethyl 4-acetyl-5-methyl-2-(4-naphthalen-2-yloxybutanoylamino)furan-3-carboxylate (PubChem CID 108763630) has the molecular formula C24H25NO6 and a molecular weight of 423.47 g/mol. Its IUPAC name is ethyl 4-acetyl-5-methyl-2-(4-naphthalen-2-yloxybutanoylamino)furan-3-carboxylate.
| Compound Name | ethyl 4-acetyl-5-methyl-2-(4-naphthalen-2-yloxybutanoylamino)furan-3-carboxylate |
|---|---|
| PubChem CID | 108763630 |
| Molecular Formula | C24H25NO6 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | ethyl 4-acetyl-5-methyl-2-(4-naphthalen-2-yloxybutanoylamino)furan-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CCCOc2ccc3ccccc3c2)oc(C)c1C(C)=O |
| InChI | InChI=1S/C24H25NO6/c1-4-29-24(28)22-21(15(2)26)16(3)31-23(22)25-20(27)10-7-13-30-19-12-11-17-8-5-6-9-18(17)14-19/h5-6,8-9,11-12,14H,4,7,10,13H2,1-3H3,(H,25,27) |
| InChIKey | XDHQHNXZMDKILB-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|