C20H22N2O6 — CID 108733760
ethyl 4-carbamoyl-2-methyl-5-[(5-oxo-5-phenylpentanoyl)amino]furan-3-carboxylate (PubChem CID 108733760) has the molecular formula C20H22N2O6 and a molecular weight of 386.40 g/mol. Its IUPAC name is ethyl 4-carbamoyl-2-methyl-5-[(5-oxo-5-phenylpentanoyl)amino]furan-3-carboxylate.
| Compound Name | ethyl 4-carbamoyl-2-methyl-5-[(5-oxo-5-phenylpentanoyl)amino]furan-3-carboxylate |
|---|---|
| PubChem CID | 108733760 |
| Molecular Formula | C20H22N2O6 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | ethyl 4-carbamoyl-2-methyl-5-[(5-oxo-5-phenylpentanoyl)amino]furan-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)oc(NC(=O)CCCC(=O)c2ccccc2)c1C(N)=O |
| InChI | InChI=1S/C20H22N2O6/c1-3-27-20(26)16-12(2)28-19(17(16)18(21)25)22-15(24)11-7-10-14(23)13-8-5-4-6-9-13/h4-6,8-9H,3,7,10-11H2,1-2H3,(H2,21,25)(H,22,24) |
| InChIKey | ORRKNDXSTAQQBL-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 128.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |