C13H15BClFO4 — CID 131743502
2-chloro-3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid (PubChem CID 131743502) has the molecular formula C13H15BClFO4 and a molecular weight of 300.52 g/mol. Its IUPAC name is 2-chloro-3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid.
| Compound Name | 2-chloro-3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
|---|---|
| PubChem CID | 131743502 |
| Molecular Formula | C13H15BClFO4 |
| Molecular Weight | 300.52 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 2-chloro-3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
| SMILES | CC1(C)OB(c2cc(F)c(Cl)c(C(=O)O)c2)OC1(C)C |
| InChI | InChI=1S/C13H15BClFO4/c1-12(2)13(3,4)20-14(19-12)7-5-8(11(17)18)10(15)9(16)6-7/h5-6H,1-4H3,(H,17,18) |
| InChIKey | DTOAGQFRISNWLA-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.52 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|