C15H21BFNO4 — CID 154394877
2-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethylcarbamic acid (PubChem CID 154394877) has the molecular formula C15H21BFNO4 and a molecular weight of 309.15 g/mol. Its IUPAC name is 2-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethylcarbamic acid.
| Compound Name | 2-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethylcarbamic acid |
|---|---|
| PubChem CID | 154394877 |
| Molecular Formula | C15H21BFNO4 |
| Molecular Weight | 309.15 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 2-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethylcarbamic acid |
| SMILES | CC1(C)OB(c2ccc(CCNC(=O)O)c(F)c2)OC1(C)C |
| InChI | InChI=1S/C15H21BFNO4/c1-14(2)15(3,4)22-16(21-14)11-6-5-10(12(17)9-11)7-8-18-13(19)20/h5-6,9,18H,7-8H2,1-4H3,(H,19,20) |
| InChIKey | NGRWPXMWKUWFMC-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.15 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|