C32H37BFNO4 — CID 87090023
2-(benzhydrylideneamino)-2-[[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-3,3-dimethylbutanoic acid (PubChem CID 87090023) has the molecular formula C32H37BFNO4 and a molecular weight of 529.46 g/mol. Its IUPAC name is 2-(benzhydrylideneamino)-2-[[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-3,3-dimethylbutanoic acid.
| Compound Name | 2-(benzhydrylideneamino)-2-[[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 87090023 |
| Molecular Formula | C32H37BFNO4 |
| Molecular Weight | 529.46 g/mol |
| Exact Mass | 529.28 |
| IUPAC Name | 2-(benzhydrylideneamino)-2-[[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(C)C(Cc1ccc(B2OC(C)(C)C(C)(C)O2)cc1F)(N=C(c1ccccc1)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C32H37BFNO4/c1-29(2,3)32(28(36)37,35-27(22-14-10-8-11-15-22)23-16-12-9-13-17-23)21-24-18-19-25(20-26(24)34)33-38-30(4,5)31(6,7)39-33/h8-20H,21H2,1-7H3,(H,36,37) |
| InChIKey | OCKXOKFTUQZYKI-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.46 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|