C21H26BFO2S — CID 113249717
2-[4-[(2,4-dimethylphenyl)sulfanylmethyl]-3-fluorophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 113249717) has the molecular formula C21H26BFO2S and a molecular weight of 372.31 g/mol. Its IUPAC name is 2-[4-[(2,4-dimethylphenyl)sulfanylmethyl]-3-fluorophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[4-[(2,4-dimethylphenyl)sulfanylmethyl]-3-fluorophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 113249717 |
| Molecular Formula | C21H26BFO2S |
| Molecular Weight | 372.31 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 2-[4-[(2,4-dimethylphenyl)sulfanylmethyl]-3-fluorophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | Cc1ccc(SCc2ccc(B3OC(C)(C)C(C)(C)O3)cc2F)c(C)c1 |
| InChI | InChI=1S/C21H26BFO2S/c1-14-7-10-19(15(2)11-14)26-13-16-8-9-17(12-18(16)23)22-24-20(3,4)21(5,6)25-22/h7-12H,13H2,1-6H3 |
| InChIKey | RXJUQHSWWLYGIW-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.31 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|