C19H26BF2NO4 — CID 140821318
2-[1-[2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidin-4-yl]acetic acid (PubChem CID 140821318) has the molecular formula C19H26BF2NO4 and a molecular weight of 381.23 g/mol. Its IUPAC name is 2-[1-[2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidin-4-yl]acetic acid.
| Compound Name | 2-[1-[2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 140821318 |
| Molecular Formula | C19H26BF2NO4 |
| Molecular Weight | 381.23 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 2-[1-[2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidin-4-yl]acetic acid |
| SMILES | CC1(C)OB(c2cc(F)c(N3CCC(CC(=O)O)CC3)c(F)c2)OC1(C)C |
| InChI | InChI=1S/C19H26BF2NO4/c1-18(2)19(3,4)27-20(26-18)13-10-14(21)17(15(22)11-13)23-7-5-12(6-8-23)9-16(24)25/h10-12H,5-9H2,1-4H3,(H,24,25) |
| InChIKey | ZUMPBXVXSQQDCT-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.23 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|