C45H54B2F2N2O4 — CID 76668802
1-[4-[2,5-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrolidin-1-yl]-2,6-difluorophenyl]-4-phenylpiperidine (PubChem CID 76668802) has the molecular formula C45H54B2F2N2O4 and a molecular weight of 746.56 g/mol. Its IUPAC name is 1-[4-[2,5-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrolidin-1-yl]-2,6-difluorophenyl]-4-phenylpiperidine.
| Compound Name | 1-[4-[2,5-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrolidin-1-yl]-2,6-difluorophenyl]-4-phenylpiperidine |
|---|---|
| PubChem CID | 76668802 |
| Molecular Formula | C45H54B2F2N2O4 |
| Molecular Weight | 746.56 g/mol |
| Exact Mass | 746.42 |
| IUPAC Name | 1-[4-[2,5-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrolidin-1-yl]-2,6-difluorophenyl]-4-phenylpiperidine |
| SMILES | CC1(C)OB(c2ccc(C3CCC(c4ccc(B5OC(C)(C)C(C)(C)O5)cc4)N3c3cc(F)c(N4CCC(c5ccccc5)CC4)c(F)c3)cc2)OC1(C)C |
| InChI | InChI=1S/C45H54B2F2N2O4/c1-42(2)43(3,4)53-46(52-42)34-18-14-32(15-19-34)39-22-23-40(33-16-20-35(21-17-33)47-54-44(5,6)45(7,8)55-47)51(39)36-28-37(48)41(38(49)29-36)50-26-24-31(25-27-50)30-12-10-9-11-13-30/h9-21,28-29,31,39-40H,22-27H2,1-8H3 |
| InChIKey | GPVIGUYIKYYIQH-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.56 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|