C35H42B2F3NO4 — CID 67237507
(2R,5R)-2,5-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1-[4-(trifluoromethyl)phenyl]pyrrolidine (PubChem CID 67237507) has the molecular formula C35H42B2F3NO4 and a molecular weight of 619.34 g/mol. Its IUPAC name is (2R,5R)-2,5-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1-[4-(trifluoromethyl)phenyl]pyrrolidine.
| Compound Name | (2R,5R)-2,5-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1-[4-(trifluoromethyl)phenyl]pyrrolidine |
|---|---|
| PubChem CID | 67237507 |
| Molecular Formula | C35H42B2F3NO4 |
| Molecular Weight | 619.34 g/mol |
| Exact Mass | 619.33 |
| IUPAC Name | (2R,5R)-2,5-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1-[4-(trifluoromethyl)phenyl]pyrrolidine |
| SMILES | CC1(C)OB(c2ccc([C@H]3CC[C@H](c4ccc(B5OC(C)(C)C(C)(C)O5)cc4)N3c3ccc(C(F)(F)F)cc3)cc2)OC1(C)C |
| InChI | InChI=1S/C35H42B2F3NO4/c1-31(2)32(3,4)43-36(42-31)26-15-9-23(10-16-26)29-21-22-30(41(29)28-19-13-25(14-20-28)35(38,39)40)24-11-17-27(18-12-24)37-44-33(5,6)34(7,8)45-37/h9-20,29-30H,21-22H2,1-8H3/t29-,30-/m1/s1 |
| InChIKey | IYMRQLFCMHJEQK-LOYHVIPDSA-N |
| XLogP | 7.39 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.34 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|